C21H34O3 — CID 146406541
5-[3-(4-ethylphenoxy)-3-methylbutoxy]-5-methylheptan-2-one (PubChem CID 146406541) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 5-[3-(4-ethylphenoxy)-3-methylbutoxy]-5-methylheptan-2-one.
| Compound Name | 5-[3-(4-ethylphenoxy)-3-methylbutoxy]-5-methylheptan-2-one |
|---|---|
| PubChem CID | 146406541 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 5-[3-(4-ethylphenoxy)-3-methylbutoxy]-5-methylheptan-2-one |
| SMILES | CCc1ccc(OC(C)(C)CCOC(C)(CC)CCC(C)=O)cc1 |
| InChI | InChI=1S/C21H34O3/c1-7-18-9-11-19(12-10-18)24-20(4,5)15-16-23-21(6,8-2)14-13-17(3)22/h9-12H,7-8,13-16H2,1-6H3 |
| InChIKey | LQTLOCAXXZOZQZ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |