C22H35N3O4 — CID 56552310
2-methylpropyl N-[3-[[5-(dipropylamino)-5-oxopentanoyl]amino]phenyl]carbamate (PubChem CID 56552310) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-methylpropyl N-[3-[[5-(dipropylamino)-5-oxopentanoyl]amino]phenyl]carbamate.
| Compound Name | 2-methylpropyl N-[3-[[5-(dipropylamino)-5-oxopentanoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 56552310 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 2-methylpropyl N-[3-[[5-(dipropylamino)-5-oxopentanoyl]amino]phenyl]carbamate |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)Nc1cccc(NC(=O)OCC(C)C)c1 |
| InChI | InChI=1S/C22H35N3O4/c1-5-13-25(14-6-2)21(27)12-8-11-20(26)23-18-9-7-10-19(15-18)24-22(28)29-16-17(3)4/h7,9-10,15,17H,5-6,8,11-14,16H2,1-4H3,(H,23,26)(H,24,28) |
| InChIKey | MZGKXFNIZDDPBP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |