C17H27ClN4O3 — CID 154913108
N-[3-chloro-4-(dimethylamino)phenyl]-3-(4-methylpiperazin-1-yl)propanamide;formic acid (PubChem CID 154913108) has the molecular formula C17H27ClN4O3 and a molecular weight of 370.88 g/mol. Its IUPAC name is N-[3-chloro-4-(dimethylamino)phenyl]-3-(4-methylpiperazin-1-yl)propanamide;formic acid.
| Compound Name | N-[3-chloro-4-(dimethylamino)phenyl]-3-(4-methylpiperazin-1-yl)propanamide;formic acid |
|---|---|
| PubChem CID | 154913108 |
| Molecular Formula | C17H27ClN4O3 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-[3-chloro-4-(dimethylamino)phenyl]-3-(4-methylpiperazin-1-yl)propanamide;formic acid |
| SMILES | CN1CCN(CCC(=O)Nc2ccc(N(C)C)c(Cl)c2)CC1.O=CO |
| InChI | InChI=1S/C16H25ClN4O.CH2O2/c1-19(2)15-5-4-13(12-14(15)17)18-16(22)6-7-21-10-8-20(3)9-11-21;2-1-3/h4-5,12H,6-11H2,1-3H3,(H,18,22);1H,(H,2,3) |
| InChIKey | XMJJZRMSOBYEAH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|