C17H25ClFN3O — CID 124755083
N-(3-chloro-4-fluorophenyl)-3-[(4R)-4-(dimethylamino)azepan-1-yl]propanamide (PubChem CID 124755083) has the molecular formula C17H25ClFN3O and a molecular weight of 341.86 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-[(4R)-4-(dimethylamino)azepan-1-yl]propanamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-[(4R)-4-(dimethylamino)azepan-1-yl]propanamide |
|---|---|
| PubChem CID | 124755083 |
| Molecular Formula | C17H25ClFN3O |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-[(4R)-4-(dimethylamino)azepan-1-yl]propanamide |
| SMILES | CN(C)[C@@H]1CCCN(CCC(=O)Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H25ClFN3O/c1-21(2)14-4-3-9-22(10-7-14)11-8-17(23)20-13-5-6-16(19)15(18)12-13/h5-6,12,14H,3-4,7-11H2,1-2H3,(H,20,23)/t14-/m1/s1 |
| InChIKey | POLTVZZTSVBYPQ-CQSZACIVSA-N |
| XLogP | 3.22 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |