C28H39N3O4 — CID 93019498
N-[[2-(dimethylamino)-5-[(2-phenoxyacetyl)amino]phenyl]methyl]-3,3-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]butanamide (PubChem CID 93019498) has the molecular formula C28H39N3O4 and a molecular weight of 481.64 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-5-[(2-phenoxyacetyl)amino]phenyl]methyl]-3,3-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]butanamide.
| Compound Name | N-[[2-(dimethylamino)-5-[(2-phenoxyacetyl)amino]phenyl]methyl]-3,3-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 93019498 |
| Molecular Formula | C28H39N3O4 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | N-[[2-(dimethylamino)-5-[(2-phenoxyacetyl)amino]phenyl]methyl]-3,3-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]butanamide |
| SMILES | CN(C)c1ccc(NC(=O)COc2ccccc2)cc1CN(C[C@H]1CCCO1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C28H39N3O4/c1-28(2,3)17-27(33)31(19-24-12-9-15-34-24)18-21-16-22(13-14-25(21)30(4)5)29-26(32)20-35-23-10-7-6-8-11-23/h6-8,10-11,13-14,16,24H,9,12,15,17-20H2,1-5H3,(H,29,32)/t24-/m1/s1 |
| InChIKey | MBDOGFJSZGINJC-XMMPIXPASA-N |
| XLogP | 4.71 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|