C24H38ClN3O3 — CID 93019489
N-[[5-(4-chlorobutanoylamino)-2-(dimethylamino)phenyl]methyl]-3,3-dimethyl-N-[[(2S)-oxolan-2-yl]methyl]butanamide (PubChem CID 93019489) has the molecular formula C24H38ClN3O3 and a molecular weight of 452.04 g/mol. Its IUPAC name is N-[[5-(4-chlorobutanoylamino)-2-(dimethylamino)phenyl]methyl]-3,3-dimethyl-N-[[(2S)-oxolan-2-yl]methyl]butanamide.
| Compound Name | N-[[5-(4-chlorobutanoylamino)-2-(dimethylamino)phenyl]methyl]-3,3-dimethyl-N-[[(2S)-oxolan-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 93019489 |
| Molecular Formula | C24H38ClN3O3 |
| Molecular Weight | 452.04 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | N-[[5-(4-chlorobutanoylamino)-2-(dimethylamino)phenyl]methyl]-3,3-dimethyl-N-[[(2S)-oxolan-2-yl]methyl]butanamide |
| SMILES | CN(C)c1ccc(NC(=O)CCCCl)cc1CN(C[C@@H]1CCCO1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C24H38ClN3O3/c1-24(2,3)15-23(30)28(17-20-8-7-13-31-20)16-18-14-19(10-11-21(18)27(4)5)26-22(29)9-6-12-25/h10-11,14,20H,6-9,12-13,15-17H2,1-5H3,(H,26,29)/t20-/m0/s1 |
| InChIKey | LSXCNRKEEUHDIH-FQEVSTJZSA-N |
| XLogP | 4.65 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.04 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|