C20H28N4O4 — CID 52513315
3-[3-(2-oxoimidazolidin-1-yl)phenyl]-1,1-bis[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 52513315) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-[3-(2-oxoimidazolidin-1-yl)phenyl]-1,1-bis[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 3-[3-(2-oxoimidazolidin-1-yl)phenyl]-1,1-bis[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 52513315 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 3-[3-(2-oxoimidazolidin-1-yl)phenyl]-1,1-bis[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(Nc1cccc(N2CCNC2=O)c1)N(C[C@@H]1CCCO1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C20H28N4O4/c25-19-21-8-9-24(19)16-5-1-4-15(12-16)22-20(26)23(13-17-6-2-10-27-17)14-18-7-3-11-28-18/h1,4-5,12,17-18H,2-3,6-11,13-14H2,(H,21,25)(H,22,26)/t17-,18-/m0/s1 |
| InChIKey | OQKDEVIILCTZRJ-ROUUACIJSA-N |
| XLogP | 2.41 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |