C11H18N2OS2 — CID 115571943
1-ethyl-3-(2-methoxyethyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 115571943) has the molecular formula C11H18N2OS2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-ethyl-3-(2-methoxyethyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-ethyl-3-(2-methoxyethyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 115571943 |
| Molecular Formula | C11H18N2OS2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1-ethyl-3-(2-methoxyethyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCN(Cc1cccs1)C(=S)NCCOC |
| InChI | InChI=1S/C11H18N2OS2/c1-3-13(9-10-5-4-8-16-10)11(15)12-6-7-14-2/h4-5,8H,3,6-7,9H2,1-2H3,(H,12,15) |
| InChIKey | GBQSWSMOUAFUCQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|