C20H24ClN3OS2 — CID 2158048
1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-(2-methoxyethyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 2158048) has the molecular formula C20H24ClN3OS2 and a molecular weight of 422.02 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-(2-methoxyethyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-(2-methoxyethyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2158048 |
| Molecular Formula | C20H24ClN3OS2 |
| Molecular Weight | 422.02 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-(2-methoxyethyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | COCCNC(=S)N(CCc1c(C)[nH]c2ccc(Cl)cc12)Cc1cccs1 |
| InChI | InChI=1S/C20H24ClN3OS2/c1-14-17(18-12-15(21)5-6-19(18)23-14)7-9-24(13-16-4-3-11-27-16)20(26)22-8-10-25-2/h3-6,11-12,23H,7-10,13H2,1-2H3,(H,22,26) |
| InChIKey | DWZFYKRGLXCPJR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.02 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|