C26H27ClN4S — CID 2158005
1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-(2-phenylethyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 2158005) has the molecular formula C26H27ClN4S and a molecular weight of 463.05 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-(2-phenylethyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-(2-phenylethyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2158005 |
| Molecular Formula | C26H27ClN4S |
| Molecular Weight | 463.05 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-3-(2-phenylethyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | Cc1[nH]c2ccc(Cl)cc2c1CCN(Cc1cccnc1)C(=S)NCCc1ccccc1 |
| InChI | InChI=1S/C26H27ClN4S/c1-19-23(24-16-22(27)9-10-25(24)30-19)12-15-31(18-21-8-5-13-28-17-21)26(32)29-14-11-20-6-3-2-4-7-20/h2-10,13,16-17,30H,11-12,14-15,18H2,1H3,(H,29,32) |
| InChIKey | BWQLEQCHPGIQSK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.05 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|