C27H30N4S — CID 2157816
1-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-3-(2-phenylethyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 2157816) has the molecular formula C27H30N4S and a molecular weight of 442.63 g/mol. Its IUPAC name is 1-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-3-(2-phenylethyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-3-(2-phenylethyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2157816 |
| Molecular Formula | C27H30N4S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 1-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-3-(2-phenylethyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | Cc1ccc2[nH]c(C)c(CCN(Cc3cccnc3)C(=S)NCCc3ccccc3)c2c1 |
| InChI | InChI=1S/C27H30N4S/c1-20-10-11-26-25(17-20)24(21(2)30-26)13-16-31(19-23-9-6-14-28-18-23)27(32)29-15-12-22-7-4-3-5-8-22/h3-11,14,17-18,30H,12-13,15-16,19H2,1-2H3,(H,29,32) |
| InChIKey | IEJCEIOBYFTHAP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|