C27H30N4O3S — CID 2158080
3-(2,5-dimethoxyphenyl)-1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 2158080) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-(2,5-dimethoxyphenyl)-1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2158080 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | COc1ccc(OC)c(NC(=S)N(CCc2c(C)[nH]c3ccc(OC)cc23)Cc2cccnc2)c1 |
| InChI | InChI=1S/C27H30N4O3S/c1-18-22(23-14-20(32-2)7-9-24(23)29-18)11-13-31(17-19-6-5-12-28-16-19)27(35)30-25-15-21(33-3)8-10-26(25)34-4/h5-10,12,14-16,29H,11,13,17H2,1-4H3,(H,30,35) |
| InChIKey | YZIZECKGKHLGNO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|