C26H28N4OS — CID 2158115
1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-3-(3-methylphenyl)-1-(pyridin-4-ylmethyl)thiourea (PubChem CID 2158115) has the molecular formula C26H28N4OS and a molecular weight of 444.60 g/mol. Its IUPAC name is 1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-3-(3-methylphenyl)-1-(pyridin-4-ylmethyl)thiourea.
| Compound Name | 1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-3-(3-methylphenyl)-1-(pyridin-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2158115 |
| Molecular Formula | C26H28N4OS |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-3-(3-methylphenyl)-1-(pyridin-4-ylmethyl)thiourea |
| SMILES | COc1ccc2[nH]c(C)c(CCN(Cc3ccncc3)C(=S)Nc3cccc(C)c3)c2c1 |
| InChI | InChI=1S/C26H28N4OS/c1-18-5-4-6-21(15-18)29-26(32)30(17-20-9-12-27-13-10-20)14-11-23-19(2)28-25-8-7-22(31-3)16-24(23)25/h4-10,12-13,15-16,28H,11,14,17H2,1-3H3,(H,29,32) |
| InChIKey | OQKWOEXLHBRPDE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|