C25H26N4S — CID 2157752
1-[2-(2-methyl-1H-indol-3-yl)ethyl]-3-(3-methylphenyl)-1-(pyridin-4-ylmethyl)thiourea (PubChem CID 2157752) has the molecular formula C25H26N4S and a molecular weight of 414.58 g/mol. Its IUPAC name is 1-[2-(2-methyl-1H-indol-3-yl)ethyl]-3-(3-methylphenyl)-1-(pyridin-4-ylmethyl)thiourea.
| Compound Name | 1-[2-(2-methyl-1H-indol-3-yl)ethyl]-3-(3-methylphenyl)-1-(pyridin-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2157752 |
| Molecular Formula | C25H26N4S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1-[2-(2-methyl-1H-indol-3-yl)ethyl]-3-(3-methylphenyl)-1-(pyridin-4-ylmethyl)thiourea |
| SMILES | Cc1cccc(NC(=S)N(CCc2c(C)[nH]c3ccccc23)Cc2ccncc2)c1 |
| InChI | InChI=1S/C25H26N4S/c1-18-6-5-7-21(16-18)28-25(30)29(17-20-10-13-26-14-11-20)15-12-22-19(2)27-24-9-4-3-8-23(22)24/h3-11,13-14,16,27H,12,15,17H2,1-2H3,(H,28,30) |
| InChIKey | SALIYORIUQLVPH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|