C23H22ClN3OS — CID 4156509
3-(3-chlorophenyl)-1-(furan-2-ylmethyl)-1-[2-(2-methyl-1H-indol-3-yl)ethyl]thiourea (PubChem CID 4156509) has the molecular formula C23H22ClN3OS and a molecular weight of 423.97 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-(furan-2-ylmethyl)-1-[2-(2-methyl-1H-indol-3-yl)ethyl]thiourea.
| Compound Name | 3-(3-chlorophenyl)-1-(furan-2-ylmethyl)-1-[2-(2-methyl-1H-indol-3-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 4156509 |
| Molecular Formula | C23H22ClN3OS |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 3-(3-chlorophenyl)-1-(furan-2-ylmethyl)-1-[2-(2-methyl-1H-indol-3-yl)ethyl]thiourea |
| SMILES | Cc1[nH]c2ccccc2c1CCN(Cc1ccco1)C(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H22ClN3OS/c1-16-20(21-9-2-3-10-22(21)25-16)11-12-27(15-19-8-5-13-28-19)23(29)26-18-7-4-6-17(24)14-18/h2-10,13-14,25H,11-12,15H2,1H3,(H,26,29) |
| InChIKey | GLYOMSKKJSLYFN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 44.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|