C28H30FN3O3S — CID 2157738
3-(4-fluorophenyl)-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea (PubChem CID 2157738) has the molecular formula C28H30FN3O3S and a molecular weight of 507.63 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 3-(4-fluorophenyl)-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 2157738 |
| Molecular Formula | C28H30FN3O3S |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
| SMILES | COc1cc(CN(CCc2c(C)[nH]c3ccccc23)C(=S)Nc2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C28H30FN3O3S/c1-18-22(23-7-5-6-8-24(23)30-18)13-14-32(28(36)31-21-11-9-20(29)10-12-21)17-19-15-25(33-2)27(35-4)26(16-19)34-3/h5-12,15-16,30H,13-14,17H2,1-4H3,(H,31,36) |
| InChIKey | DXFJWJKBCVHZPE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 58.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|