C26H34ClN3O3S — CID 2158022
3-tert-butyl-1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea (PubChem CID 2158022) has the molecular formula C26H34ClN3O3S and a molecular weight of 504.10 g/mol. Its IUPAC name is 3-tert-butyl-1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 3-tert-butyl-1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 2158022 |
| Molecular Formula | C26H34ClN3O3S |
| Molecular Weight | 504.10 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 3-tert-butyl-1-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
| SMILES | COc1cc(CN(CCc2c(C)[nH]c3ccc(Cl)cc23)C(=S)NC(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C26H34ClN3O3S/c1-16-19(20-14-18(27)8-9-21(20)28-16)10-11-30(25(34)29-26(2,3)4)15-17-12-22(31-5)24(33-7)23(13-17)32-6/h8-9,12-14,28H,10-11,15H2,1-7H3,(H,29,34) |
| InChIKey | QYZBFQMVVWOIKI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.10 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|