C19H23N3S2 — CID 2157872
1-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-3-methyl-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 2157872) has the molecular formula C19H23N3S2 and a molecular weight of 357.55 g/mol. Its IUPAC name is 1-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-3-methyl-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-3-methyl-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2157872 |
| Molecular Formula | C19H23N3S2 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-3-methyl-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CNC(=S)N(CCc1c(C)[nH]c2ccc(C)cc12)Cc1cccs1 |
| InChI | InChI=1S/C19H23N3S2/c1-13-6-7-18-17(11-13)16(14(2)21-18)8-9-22(19(23)20-3)12-15-5-4-10-24-15/h4-7,10-11,21H,8-9,12H2,1-3H3,(H,20,23) |
| InChIKey | QKCPZWFKHBBANF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|