C20H25N3OS2 — CID 2158141
3-ethyl-1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 2158141) has the molecular formula C20H25N3OS2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 3-ethyl-1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-ethyl-1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2158141 |
| Molecular Formula | C20H25N3OS2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 3-ethyl-1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCNC(=S)N(CCc1c(C)[nH]c2ccc(OC)cc12)Cc1cccs1 |
| InChI | InChI=1S/C20H25N3OS2/c1-4-21-20(25)23(13-16-6-5-11-26-16)10-9-17-14(2)22-19-8-7-15(24-3)12-18(17)19/h5-8,11-12,22H,4,9-10,13H2,1-3H3,(H,21,25) |
| InChIKey | IGLUXYYMWZHPEI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|