C19H24N2S — CID 3522415
1,1-dibenzyl-3-butylthiourea (PubChem CID 3522415) has the molecular formula C19H24N2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 1,1-dibenzyl-3-butylthiourea.
| Compound Name | 1,1-dibenzyl-3-butylthiourea |
|---|---|
| PubChem CID | 3522415 |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1,1-dibenzyl-3-butylthiourea |
| SMILES | CCCCNC(=S)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2S/c1-2-3-14-20-19(22)21(15-17-10-6-4-7-11-17)16-18-12-8-5-9-13-18/h4-13H,2-3,14-16H2,1H3,(H,20,22) |
| InChIKey | NJTPTVDFOFPBAI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|