C27H32N2O2S — CID 4135206
1,1-dibenzyl-3-[2-(3,4-diethoxyphenyl)ethyl]thiourea (PubChem CID 4135206) has the molecular formula C27H32N2O2S and a molecular weight of 448.63 g/mol. Its IUPAC name is 1,1-dibenzyl-3-[2-(3,4-diethoxyphenyl)ethyl]thiourea.
| Compound Name | 1,1-dibenzyl-3-[2-(3,4-diethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 4135206 |
| Molecular Formula | C27H32N2O2S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 1,1-dibenzyl-3-[2-(3,4-diethoxyphenyl)ethyl]thiourea |
| SMILES | CCOc1ccc(CCNC(=S)N(Cc2ccccc2)Cc2ccccc2)cc1OCC |
| InChI | InChI=1S/C27H32N2O2S/c1-3-30-25-16-15-22(19-26(25)31-4-2)17-18-28-27(32)29(20-23-11-7-5-8-12-23)21-24-13-9-6-10-14-24/h5-16,19H,3-4,17-18,20-21H2,1-2H3,(H,28,32) |
| InChIKey | UVVPAFIVFAHNPW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|