C23H25F3N4S — CID 17375426
1,1-dibenzyl-3-[3-[4-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea (PubChem CID 17375426) has the molecular formula C23H25F3N4S and a molecular weight of 446.54 g/mol. Its IUPAC name is 1,1-dibenzyl-3-[3-[4-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea.
| Compound Name | 1,1-dibenzyl-3-[3-[4-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 17375426 |
| Molecular Formula | C23H25F3N4S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1,1-dibenzyl-3-[3-[4-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea |
| SMILES | Cc1cn(CCCNC(=S)N(Cc2ccccc2)Cc2ccccc2)nc1C(F)(F)F |
| InChI | InChI=1S/C23H25F3N4S/c1-18-15-30(28-21(18)23(24,25)26)14-8-13-27-22(31)29(16-19-9-4-2-5-10-19)17-20-11-6-3-7-12-20/h2-7,9-12,15H,8,13-14,16-17H2,1H3,(H,27,31) |
| InChIKey | CMCZDUSXNQBPNP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|