C18H31NO — CID 10516679
4-(4-aminobutyl)-2,6-ditert-butylphenol (PubChem CID 10516679) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 4-(4-aminobutyl)-2,6-ditert-butylphenol.
| Compound Name | 4-(4-aminobutyl)-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 10516679 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 4-(4-aminobutyl)-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CCCCN)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H31NO/c1-17(2,3)14-11-13(9-7-8-10-19)12-15(16(14)20)18(4,5)6/h11-12,20H,7-10,19H2,1-6H3 |
| InChIKey | PDNQVPYDNKCNSB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|