C17H27Na2O4P — CID 172808493
disodium;2,6-ditert-butyl-4-(3-phosphonatopropyl)phenol (PubChem CID 172808493) has the molecular formula C17H27Na2O4P and a molecular weight of 372.35 g/mol. Its IUPAC name is disodium;2,6-ditert-butyl-4-(3-phosphonatopropyl)phenol.
| Compound Name | disodium;2,6-ditert-butyl-4-(3-phosphonatopropyl)phenol |
|---|---|
| PubChem CID | 172808493 |
| Molecular Formula | C17H27Na2O4P |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | disodium;2,6-ditert-butyl-4-(3-phosphonatopropyl)phenol |
| SMILES | CC(C)(C)c1cc(CCCP(=O)([O-])[O-])cc(C(C)(C)C)c1O.[Na+].[Na+] |
| InChI | InChI=1S/C17H29O4P.2Na/c1-16(2,3)13-10-12(8-7-9-22(19,20)21)11-14(15(13)18)17(4,5)6;;/h10-11,18H,7-9H2,1-6H3,(H2,19,20,21);;/q;2*+1/p-2 |
| InChIKey | RVOMGFIWGHLVHP-UHFFFAOYSA-L |
| XLogP | -3.16 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|