C32H52NiO8P2 — CID 15752109
bis((3,5-ditert-butyl-4-hydroxyphenyl)methyl-methoxyphosphinate);nickel(2+) (PubChem CID 15752109) has the molecular formula C32H52NiO8P2 and a molecular weight of 685.40 g/mol. Its IUPAC name is bis((3,5-ditert-butyl-4-hydroxyphenyl)methyl-methoxyphosphinate);nickel(2+).
| Compound Name | bis((3,5-ditert-butyl-4-hydroxyphenyl)methyl-methoxyphosphinate);nickel(2+) |
|---|---|
| PubChem CID | 15752109 |
| Molecular Formula | C32H52NiO8P2 |
| Molecular Weight | 685.40 g/mol |
| Exact Mass | 684.25 |
| IUPAC Name | bis((3,5-ditert-butyl-4-hydroxyphenyl)methyl-methoxyphosphinate);nickel(2+) |
| SMILES | COP(=O)([O-])Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.COP(=O)([O-])Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.[Ni+2] |
| InChI | InChI=1S/2C16H27O4P.Ni/c2*1-15(2,3)12-8-11(10-21(18,19)20-7)9-13(14(12)17)16(4,5)6;/h2*8-9,17H,10H2,1-7H3,(H,18,19);/q;;+2/p-2 |
| InChIKey | MKUMRHSVMRDPBJ-UHFFFAOYSA-L |
| XLogP | 7.37 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.40 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|