C16H27O5P — CID 5134279
(3,5-ditert-butyl-4-hydroxyphenyl) dimethyl phosphate (PubChem CID 5134279) has the molecular formula C16H27O5P and a molecular weight of 330.36 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl) dimethyl phosphate.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl) dimethyl phosphate |
|---|---|
| PubChem CID | 5134279 |
| Molecular Formula | C16H27O5P |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl) dimethyl phosphate |
| SMILES | COP(=O)(OC)Oc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H27O5P/c1-15(2,3)12-9-11(21-22(18,19-7)20-8)10-13(14(12)17)16(4,5)6/h9-10,17H,1-8H3 |
| InChIKey | LQJXWIQPXVIPGW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|