bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate

C28H43O6P — CID 175526623

IUPACbis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate
SMILESCC(C)(C)c1cc(OP(=O)(O)Oc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1
InChIInChI=1S/C28H43O6P/c1-25(2,3)17-13-19(27(7,8)9)23(29)21(15-17)33-35(31,32)34-22-16-18(26(4,5)6)14-20(24(22)30)28(10,11)12/h13-16,29-30H,1-12H3,(H,31,32)
InChIKeyFZKJUBZNULADFH-UHFFFAOYSA-N
MW506.62 g/mol
LogP7.85
Rot. Bonds4

About bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate

bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate (PubChem CID 175526623) has the molecular formula C28H43O6P and a molecular weight of 506.62 g/mol. Its IUPAC name is bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate.

Molecular Properties

Compound Namebis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate
PubChem CID175526623
Molecular FormulaC28H43O6P
Molecular Weight506.62 g/mol
Exact Mass506.28
IUPAC Namebis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate
SMILESCC(C)(C)c1cc(OP(=O)(O)Oc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1
InChIInChI=1S/C28H43O6P/c1-25(2,3)17-13-19(27(7,8)9)23(29)21(15-17)33-35(31,32)34-22-16-18(26(4,5)6)14-20(24(22)30)28(10,11)12/h13-16,29-30H,1-12H3,(H,31,32)
InChIKeyFZKJUBZNULADFH-UHFFFAOYSA-N
XLogP7.85
TPSA96.22 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms35
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500506.62
LogP ≤ 57.85
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate?
The IUPAC name of bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate (CID 175526623) is bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate.
What is the SMILES notation for bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate?
The canonical SMILES for bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate is CC(C)(C)c1cc(OP(=O)(O)Oc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1.
What is the InChIKey of bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate?
The InChIKey is FZKJUBZNULADFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H43O6P/c1-25(2,3)17-13-19(27(7,8)9)23(29)21(15-17)33-35(31,32)34-22-16-18(26(4,5)6)14-20(24(22)30)28(10,11)12/h13-16,29-30H,1-12H3,(H,31,32).
What are the key properties of bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate?
bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate has a molecular weight of 506.62 g/mol, XLogP of 7.85, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,5-ditert-butyl-2-hydroxyphenyl) hydrogen phosphate is sourced from PubChem (CID 175526623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).