C16H23O4- — CID 7343070
2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate (PubChem CID 7343070) has the molecular formula C16H23O4- and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate.
| Compound Name | 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate |
|---|---|
| PubChem CID | 7343070 |
| Molecular Formula | C16H23O4- |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate |
| SMILES | CC(C)(C)c1cc(OCC(=O)[O-])c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H24O4/c1-15(2,3)10-7-11(16(4,5)6)14(19)12(8-10)20-9-13(17)18/h7-8,19H,9H2,1-6H3,(H,17,18)/p-1 |
| InChIKey | NJVPJGYZLYEVES-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |