C21H22O6-2 — CID 4228987
2-[4-[2-[4-(carboxylatomethoxy)-3-methylphenyl]propan-2-yl]-2-methylphenoxy]acetate (PubChem CID 4228987) has the molecular formula C21H22O6-2 and a molecular weight of 370.40 g/mol. Its IUPAC name is 2-[4-[2-[4-(carboxylatomethoxy)-3-methylphenyl]propan-2-yl]-2-methylphenoxy]acetate.
| Compound Name | 2-[4-[2-[4-(carboxylatomethoxy)-3-methylphenyl]propan-2-yl]-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 4228987 |
| Molecular Formula | C21H22O6-2 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-[4-[2-[4-(carboxylatomethoxy)-3-methylphenyl]propan-2-yl]-2-methylphenoxy]acetate |
| SMILES | Cc1cc(C(C)(C)c2ccc(OCC(=O)[O-])c(C)c2)ccc1OCC(=O)[O-] |
| InChI | InChI=1S/C21H24O6/c1-13-9-15(5-7-17(13)26-11-19(22)23)21(3,4)16-6-8-18(14(2)10-16)27-12-20(24)25/h5-10H,11-12H2,1-4H3,(H,22,23)(H,24,25)/p-2 |
| InChIKey | JOMPPCWOASJTBW-UHFFFAOYSA-L |
| XLogP | 0.89 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |