C13H20ClNO5 — CID 164512318
bis(2-hydroxyethyl)azanium;2-(4-chloro-2-methylphenoxy)acetate (PubChem CID 164512318) has the molecular formula C13H20ClNO5 and a molecular weight of 305.76 g/mol. Its IUPAC name is bis(2-hydroxyethyl)azanium;2-(4-chloro-2-methylphenoxy)acetate.
| Compound Name | bis(2-hydroxyethyl)azanium;2-(4-chloro-2-methylphenoxy)acetate |
|---|---|
| PubChem CID | 164512318 |
| Molecular Formula | C13H20ClNO5 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | bis(2-hydroxyethyl)azanium;2-(4-chloro-2-methylphenoxy)acetate |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)[O-].OCC[NH2+]CCO |
| InChI | InChI=1S/C9H9ClO3.C4H11NO2/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;6-3-1-5-2-4-7/h2-4H,5H2,1H3,(H,11,12);5-7H,1-4H2 |
| InChIKey | XQAVWNJMMDWIKG-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|