C14H18NO6- — CID 86750899
2-[4-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenoxy]acetate (PubChem CID 86750899) has the molecular formula C14H18NO6- and a molecular weight of 296.30 g/mol. Its IUPAC name is 2-[4-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenoxy]acetate.
| Compound Name | 2-[4-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenoxy]acetate |
|---|---|
| PubChem CID | 86750899 |
| Molecular Formula | C14H18NO6- |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-[4-amino-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1cc(N)ccc1OCC(=O)[O-] |
| InChI | InChI=1S/C14H19NO6/c1-14(2,3)21-13(18)8-20-11-6-9(15)4-5-10(11)19-7-12(16)17/h4-6H,7-8,15H2,1-3H3,(H,16,17)/p-1 |
| InChIKey | DYDPFVKMIZCLMU-UHFFFAOYSA-M |
| XLogP | 0.12 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|