C13H17ClO4 — CID 86631069
tert-butyl 2-[4-chloro-2-(hydroxymethyl)phenoxy]acetate (PubChem CID 86631069) has the molecular formula C13H17ClO4 and a molecular weight of 272.73 g/mol. Its IUPAC name is tert-butyl 2-[4-chloro-2-(hydroxymethyl)phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-chloro-2-(hydroxymethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 86631069 |
| Molecular Formula | C13H17ClO4 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | tert-butyl 2-[4-chloro-2-(hydroxymethyl)phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(Cl)cc1CO |
| InChI | InChI=1S/C13H17ClO4/c1-13(2,3)18-12(16)8-17-11-5-4-10(14)6-9(11)7-15/h4-6,15H,7-8H2,1-3H3 |
| InChIKey | DWBAYVLNSUTEIB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |