C10H9Cl3O2 — CID 79173766
[5-chloro-2-(2,3-dichloroprop-2-enoxy)phenyl]methanol (PubChem CID 79173766) has the molecular formula C10H9Cl3O2 and a molecular weight of 267.54 g/mol. Its IUPAC name is [5-chloro-2-(2,3-dichloroprop-2-enoxy)phenyl]methanol.
| Compound Name | [5-chloro-2-(2,3-dichloroprop-2-enoxy)phenyl]methanol |
|---|---|
| PubChem CID | 79173766 |
| Molecular Formula | C10H9Cl3O2 |
| Molecular Weight | 267.54 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | [5-chloro-2-(2,3-dichloroprop-2-enoxy)phenyl]methanol |
| SMILES | OCc1cc(Cl)ccc1OCC(Cl)=CCl |
| InChI | InChI=1S/C10H9Cl3O2/c11-4-9(13)6-15-10-2-1-8(12)3-7(10)5-14/h1-4,14H,5-6H2 |
| InChIKey | GPESWAQDFWSMLO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |