C16H17ClO2 — CID 54910865
[5-chloro-2-[(3,5-dimethylphenyl)methoxy]phenyl]methanol (PubChem CID 54910865) has the molecular formula C16H17ClO2 and a molecular weight of 276.76 g/mol. Its IUPAC name is [5-chloro-2-[(3,5-dimethylphenyl)methoxy]phenyl]methanol.
| Compound Name | [5-chloro-2-[(3,5-dimethylphenyl)methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 54910865 |
| Molecular Formula | C16H17ClO2 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | [5-chloro-2-[(3,5-dimethylphenyl)methoxy]phenyl]methanol |
| SMILES | Cc1cc(C)cc(COc2ccc(Cl)cc2CO)c1 |
| InChI | InChI=1S/C16H17ClO2/c1-11-5-12(2)7-13(6-11)10-19-16-4-3-15(17)8-14(16)9-18/h3-8,18H,9-10H2,1-2H3 |
| InChIKey | NWZXVPQOKWLGAO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |