C10H6Cl3NO — CID 79168432
3-chloro-4-(2,3-dichloroprop-2-enoxy)benzonitrile (PubChem CID 79168432) has the molecular formula C10H6Cl3NO and a molecular weight of 262.52 g/mol. Its IUPAC name is 3-chloro-4-(2,3-dichloroprop-2-enoxy)benzonitrile.
| Compound Name | 3-chloro-4-(2,3-dichloroprop-2-enoxy)benzonitrile |
|---|---|
| PubChem CID | 79168432 |
| Molecular Formula | C10H6Cl3NO |
| Molecular Weight | 262.52 g/mol |
| Exact Mass | 260.95 |
| IUPAC Name | 3-chloro-4-(2,3-dichloroprop-2-enoxy)benzonitrile |
| SMILES | N#Cc1ccc(OCC(Cl)=CCl)c(Cl)c1 |
| InChI | InChI=1S/C10H6Cl3NO/c11-4-8(12)6-15-10-2-1-7(5-14)3-9(10)13/h1-4H,6H2 |
| InChIKey | IQKUAVFVNOJOKF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |