About 4-chloro-2-(2,3-dichloroprop-2-enoxy)-1-methylbenzene
4-chloro-2-(2,3-dichloroprop-2-enoxy)-1-methylbenzene (PubChem CID 79173911) has the molecular formula C10H9Cl3O
and a molecular weight of 251.54 g/mol. Its IUPAC name is 4-chloro-2-(2,3-dichloroprop-2-enoxy)-1-methylbenzene.
Analyze 4-chloro-2-(2,3-dichloroprop-2-enoxy)-1-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2,3-dichloroprop-2-enoxy)-1-methylbenzene?
The IUPAC name of 4-chloro-2-(2,3-dichloroprop-2-enoxy)-1-methylbenzene (CID 79173911) is 4-chloro-2-(2,3-dichloroprop-2-enoxy)-1-methylbenzene.
What is the SMILES notation for 4-chloro-2-(2,3-dichloroprop-2-enoxy)-1-methylbenzene?
The canonical SMILES for 4-chloro-2-(2,3-dichloroprop-2-enoxy)-1-methylbenzene is Cc1ccc(Cl)cc1OCC(Cl)=CCl.
What is the InChIKey of 4-chloro-2-(2,3-dichloroprop-2-enoxy)-1-methylbenzene?
The InChIKey is SOUNCJQHJBZOFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl3O/c1-7-2-3-8(12)4-10(7)14-6-9(13)5-11/h2-5H,6H2,1H3.
What are the key properties of 4-chloro-2-(2,3-dichloroprop-2-enoxy)-1-methylbenzene?
4-chloro-2-(2,3-dichloroprop-2-enoxy)-1-methylbenzene has a molecular weight of 251.54 g/mol, XLogP of 4.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2,3-dichloroprop-2-enoxy)-1-methylbenzene is sourced from PubChem (CID 79173911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).