C20H20ClNO3 — CID 58521928
tert-butyl 2-[4-chloro-2-[2-(2-methyl-3-pyridinyl)ethynyl]phenoxy]acetate (PubChem CID 58521928) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is tert-butyl 2-[4-chloro-2-[2-(2-methyl-3-pyridinyl)ethynyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-chloro-2-[2-(2-methyl-3-pyridinyl)ethynyl]phenoxy]acetate |
|---|---|
| PubChem CID | 58521928 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | tert-butyl 2-[4-chloro-2-[2-(2-methyl-3-pyridinyl)ethynyl]phenoxy]acetate |
| SMILES | Cc1ncccc1C#Cc1cc(Cl)ccc1OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H20ClNO3/c1-14-15(6-5-11-22-14)7-8-16-12-17(21)9-10-18(16)24-13-19(23)25-20(2,3)4/h5-6,9-12H,13H2,1-4H3 |
| InChIKey | XTAAFMKMANQBHE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|