C18H21ClN2O5S — CID 91272087
tert-butyl 2-[4-chloro-2-(4-methyl-2-methylsulfonylpyrimidin-5-yl)phenoxy]acetate (PubChem CID 91272087) has the molecular formula C18H21ClN2O5S and a molecular weight of 412.90 g/mol. Its IUPAC name is tert-butyl 2-[4-chloro-2-(4-methyl-2-methylsulfonylpyrimidin-5-yl)phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-chloro-2-(4-methyl-2-methylsulfonylpyrimidin-5-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 91272087 |
| Molecular Formula | C18H21ClN2O5S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | tert-butyl 2-[4-chloro-2-(4-methyl-2-methylsulfonylpyrimidin-5-yl)phenoxy]acetate |
| SMILES | Cc1nc(S(C)(=O)=O)ncc1-c1cc(Cl)ccc1OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H21ClN2O5S/c1-11-14(9-20-17(21-11)27(5,23)24)13-8-12(19)6-7-15(13)25-10-16(22)26-18(2,3)4/h6-9H,10H2,1-5H3 |
| InChIKey | ZFYHXKXGTNZRPQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |