C19H21ClO5S — CID 70673466
tert-butyl 2-[4-chloro-2-(4-methylsulfonylphenyl)phenoxy]acetate (PubChem CID 70673466) has the molecular formula C19H21ClO5S and a molecular weight of 396.89 g/mol. Its IUPAC name is tert-butyl 2-[4-chloro-2-(4-methylsulfonylphenyl)phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-chloro-2-(4-methylsulfonylphenyl)phenoxy]acetate |
|---|---|
| PubChem CID | 70673466 |
| Molecular Formula | C19H21ClO5S |
| Molecular Weight | 396.89 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | tert-butyl 2-[4-chloro-2-(4-methylsulfonylphenyl)phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(Cl)cc1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H21ClO5S/c1-19(2,3)25-18(21)12-24-17-10-7-14(20)11-16(17)13-5-8-15(9-6-13)26(4,22)23/h5-11H,12H2,1-4H3 |
| InChIKey | CKWBQDYKEPZHOC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.89 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |