C22H20FNO5S — CID 58521827
tert-butyl 2-[4-cyano-2-[2-(2-fluoro-5-methylsulfonylphenyl)ethynyl]phenoxy]acetate (PubChem CID 58521827) has the molecular formula C22H20FNO5S and a molecular weight of 429.47 g/mol. Its IUPAC name is tert-butyl 2-[4-cyano-2-[2-(2-fluoro-5-methylsulfonylphenyl)ethynyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-cyano-2-[2-(2-fluoro-5-methylsulfonylphenyl)ethynyl]phenoxy]acetate |
|---|---|
| PubChem CID | 58521827 |
| Molecular Formula | C22H20FNO5S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | tert-butyl 2-[4-cyano-2-[2-(2-fluoro-5-methylsulfonylphenyl)ethynyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(C#N)cc1C#Cc1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C22H20FNO5S/c1-22(2,3)29-21(25)14-28-20-10-5-15(13-24)11-17(20)7-6-16-12-18(30(4,26)27)8-9-19(16)23/h5,8-12H,14H2,1-4H3 |
| InChIKey | GWAGINIEWBBQEV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|