C23H25BrO5S — CID 56593972
tert-butyl 2-[4-bromo-2-[2-(3-propylsulfonylphenyl)ethynyl]phenoxy]acetate (PubChem CID 56593972) has the molecular formula C23H25BrO5S and a molecular weight of 493.42 g/mol. Its IUPAC name is tert-butyl 2-[4-bromo-2-[2-(3-propylsulfonylphenyl)ethynyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-bromo-2-[2-(3-propylsulfonylphenyl)ethynyl]phenoxy]acetate |
|---|---|
| PubChem CID | 56593972 |
| Molecular Formula | C23H25BrO5S |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | tert-butyl 2-[4-bromo-2-[2-(3-propylsulfonylphenyl)ethynyl]phenoxy]acetate |
| SMILES | CCCS(=O)(=O)c1cccc(C#Cc2cc(Br)ccc2OCC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H25BrO5S/c1-5-13-30(26,27)20-8-6-7-17(14-20)9-10-18-15-19(24)11-12-21(18)28-16-22(25)29-23(2,3)4/h6-8,11-12,14-15H,5,13,16H2,1-4H3 |
| InChIKey | GOGQWGXJEPVBSG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|