C25H26ClNO5 — CID 58522011
tert-butyl 2-[4-chloro-2-[2-[3-(morpholine-4-carbonyl)phenyl]ethynyl]phenoxy]acetate (PubChem CID 58522011) has the molecular formula C25H26ClNO5 and a molecular weight of 455.94 g/mol. Its IUPAC name is tert-butyl 2-[4-chloro-2-[2-[3-(morpholine-4-carbonyl)phenyl]ethynyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-chloro-2-[2-[3-(morpholine-4-carbonyl)phenyl]ethynyl]phenoxy]acetate |
|---|---|
| PubChem CID | 58522011 |
| Molecular Formula | C25H26ClNO5 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | tert-butyl 2-[4-chloro-2-[2-[3-(morpholine-4-carbonyl)phenyl]ethynyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(Cl)cc1C#Cc1cccc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C25H26ClNO5/c1-25(2,3)32-23(28)17-31-22-10-9-21(26)16-19(22)8-7-18-5-4-6-20(15-18)24(29)27-11-13-30-14-12-27/h4-6,9-10,15-16H,11-14,17H2,1-3H3 |
| InChIKey | VVASGZPNXRYTGP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|