C25H30N2O5 — CID 70002215
tert-butyl 2-[4-amino-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-phenylethynyl)phenoxy]acetate (PubChem CID 70002215) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is tert-butyl 2-[4-amino-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-phenylethynyl)phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-amino-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-phenylethynyl)phenoxy]acetate |
|---|---|
| PubChem CID | 70002215 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | tert-butyl 2-[4-amino-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-phenylethynyl)phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1cc(NC(=O)OC(C)(C)C)c(N)cc1C#Cc1ccccc1 |
| InChI | InChI=1S/C25H30N2O5/c1-24(2,3)31-22(28)16-30-21-15-20(27-23(29)32-25(4,5)6)19(26)14-18(21)13-12-17-10-8-7-9-11-17/h7-11,14-15H,16,26H2,1-6H3,(H,27,29) |
| InChIKey | XXTKLKFTERLYLO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|