C31H31IN2O6 — CID 86758210
tert-butyl N-[2-[[3-(3-iodophenyl)-3-oxopropanoyl]amino]-5-(2-methoxyethoxy)-4-(2-phenylethynyl)phenyl]carbamate (PubChem CID 86758210) has the molecular formula C31H31IN2O6 and a molecular weight of 654.50 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(3-iodophenyl)-3-oxopropanoyl]amino]-5-(2-methoxyethoxy)-4-(2-phenylethynyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(3-iodophenyl)-3-oxopropanoyl]amino]-5-(2-methoxyethoxy)-4-(2-phenylethynyl)phenyl]carbamate |
|---|---|
| PubChem CID | 86758210 |
| Molecular Formula | C31H31IN2O6 |
| Molecular Weight | 654.50 g/mol |
| Exact Mass | 654.12 |
| IUPAC Name | tert-butyl N-[2-[[3-(3-iodophenyl)-3-oxopropanoyl]amino]-5-(2-methoxyethoxy)-4-(2-phenylethynyl)phenyl]carbamate |
| SMILES | COCCOc1cc(NC(=O)OC(C)(C)C)c(NC(=O)CC(=O)c2cccc(I)c2)cc1C#Cc1ccccc1 |
| InChI | InChI=1S/C31H31IN2O6/c1-31(2,3)40-30(37)34-26-19-28(39-16-15-38-4)23(14-13-21-9-6-5-7-10-21)18-25(26)33-29(36)20-27(35)22-11-8-12-24(32)17-22/h5-12,17-19H,15-16,20H2,1-4H3,(H,33,36)(H,34,37) |
| InChIKey | ZUVFMXFEIQUCEV-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.50 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|