C26H22FN3O6 — CID 22448896
[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)-5-(2-methoxyethoxy)phenyl]carbamic acid (PubChem CID 22448896) has the molecular formula C26H22FN3O6 and a molecular weight of 491.48 g/mol. Its IUPAC name is [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)-5-(2-methoxyethoxy)phenyl]carbamic acid.
| Compound Name | [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)-5-(2-methoxyethoxy)phenyl]carbamic acid |
|---|---|
| PubChem CID | 22448896 |
| Molecular Formula | C26H22FN3O6 |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(2-fluorophenyl)-5-(2-methoxyethoxy)phenyl]carbamic acid |
| SMILES | COCCOc1cc(NC(=O)O)c(NC(=O)CC(=O)c2cccc(C#N)c2)cc1-c1ccccc1F |
| InChI | InChI=1S/C26H22FN3O6/c1-35-9-10-36-24-13-22(30-26(33)34)21(12-19(24)18-7-2-3-8-20(18)27)29-25(32)14-23(31)17-6-4-5-16(11-17)15-28/h2-8,11-13,30H,9-10,14H2,1H3,(H,29,32)(H,33,34) |
| InChIKey | DGOBESZIGGGJRC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|