C20H20N4O4 — CID 18613412
[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(dimethylamino)-5-methylphenyl]carbamic acid (PubChem CID 18613412) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(dimethylamino)-5-methylphenyl]carbamic acid.
| Compound Name | [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(dimethylamino)-5-methylphenyl]carbamic acid |
|---|---|
| PubChem CID | 18613412 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-4-(dimethylamino)-5-methylphenyl]carbamic acid |
| SMILES | Cc1cc(NC(=O)O)c(NC(=O)CC(=O)c2cccc(C#N)c2)cc1N(C)C |
| InChI | InChI=1S/C20H20N4O4/c1-12-7-15(23-20(27)28)16(9-17(12)24(2)3)22-19(26)10-18(25)14-6-4-5-13(8-14)11-21/h4-9,23H,10H2,1-3H3,(H,22,26)(H,27,28) |
| InChIKey | VKTOPOYXAGLJMA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|