C20H17F3N4O4 — CID 18613257
[2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-5-(dimethylamino)-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 18613257) has the molecular formula C20H17F3N4O4 and a molecular weight of 434.37 g/mol. Its IUPAC name is [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-5-(dimethylamino)-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-5-(dimethylamino)-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 18613257 |
| Molecular Formula | C20H17F3N4O4 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | [2-[[3-(3-cyanophenyl)-3-oxopropanoyl]amino]-5-(dimethylamino)-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | CN(C)c1cc(NC(=O)O)c(NC(=O)CC(=O)c2cccc(C#N)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H17F3N4O4/c1-27(2)16-8-15(26-19(30)31)14(7-13(16)20(21,22)23)25-18(29)9-17(28)12-5-3-4-11(6-12)10-24/h3-8,26H,9H2,1-2H3,(H,25,29)(H,30,31) |
| InChIKey | FTOIRGAPUBDHGV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|