C24H19F3N2O5 — CID 118577328
[5-methyl-2-[[3-oxo-3-(3-phenoxyphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 118577328) has the molecular formula C24H19F3N2O5 and a molecular weight of 472.42 g/mol. Its IUPAC name is [5-methyl-2-[[3-oxo-3-(3-phenoxyphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [5-methyl-2-[[3-oxo-3-(3-phenoxyphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 118577328 |
| Molecular Formula | C24H19F3N2O5 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | [5-methyl-2-[[3-oxo-3-(3-phenoxyphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | Cc1cc(NC(=O)O)c(NC(=O)CC(=O)c2cccc(Oc3ccccc3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H19F3N2O5/c1-14-10-19(29-23(32)33)20(12-18(14)24(25,26)27)28-22(31)13-21(30)15-6-5-9-17(11-15)34-16-7-3-2-4-8-16/h2-12,29H,13H2,1H3,(H,28,31)(H,32,33) |
| InChIKey | PYZPNIRKKSWHNU-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|