C20H16F3N5O4 — CID 18548833
[5-methyl-2-[[3-oxo-3-[3-(triazol-1-yl)phenyl]propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 18548833) has the molecular formula C20H16F3N5O4 and a molecular weight of 447.37 g/mol. Its IUPAC name is [5-methyl-2-[[3-oxo-3-[3-(triazol-1-yl)phenyl]propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [5-methyl-2-[[3-oxo-3-[3-(triazol-1-yl)phenyl]propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 18548833 |
| Molecular Formula | C20H16F3N5O4 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | [5-methyl-2-[[3-oxo-3-[3-(triazol-1-yl)phenyl]propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | Cc1cc(NC(=O)O)c(NC(=O)CC(=O)c2cccc(-n3ccnn3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H16F3N5O4/c1-11-7-15(26-19(31)32)16(9-14(11)20(21,22)23)25-18(30)10-17(29)12-3-2-4-13(8-12)28-6-5-24-27-28/h2-9,26H,10H2,1H3,(H,25,30)(H,31,32) |
| InChIKey | OQDZZASUTXFCIN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|