C26H22F2N6O4 — CID 18613140
[4-(2,3-difluorophenyl)-5-(dimethylamino)-2-[[3-oxo-3-[3-(triazol-1-yl)phenyl]propanoyl]amino]phenyl]carbamic acid (PubChem CID 18613140) has the molecular formula C26H22F2N6O4 and a molecular weight of 520.50 g/mol. Its IUPAC name is [4-(2,3-difluorophenyl)-5-(dimethylamino)-2-[[3-oxo-3-[3-(triazol-1-yl)phenyl]propanoyl]amino]phenyl]carbamic acid.
| Compound Name | [4-(2,3-difluorophenyl)-5-(dimethylamino)-2-[[3-oxo-3-[3-(triazol-1-yl)phenyl]propanoyl]amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 18613140 |
| Molecular Formula | C26H22F2N6O4 |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | [4-(2,3-difluorophenyl)-5-(dimethylamino)-2-[[3-oxo-3-[3-(triazol-1-yl)phenyl]propanoyl]amino]phenyl]carbamic acid |
| SMILES | CN(C)c1cc(NC(=O)O)c(NC(=O)CC(=O)c2cccc(-n3ccnn3)c2)cc1-c1cccc(F)c1F |
| InChI | InChI=1S/C26H22F2N6O4/c1-33(2)22-13-21(31-26(37)38)20(12-18(22)17-7-4-8-19(27)25(17)28)30-24(36)14-23(35)15-5-3-6-16(11-15)34-10-9-29-32-34/h3-13,31H,14H2,1-2H3,(H,30,36)(H,37,38) |
| InChIKey | OYJUJYXXHKEEGB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|